C16H26ClNO — CID 71514006
4-chloro-N-[(3R,5S)-3,5-dimethyl-1-adamantyl]butanamide (PubChem CID 71514006) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 4-chloro-N-[(3R,5S)-3,5-dimethyl-1-adamantyl]butanamide.
| Compound Name | 4-chloro-N-[(3R,5S)-3,5-dimethyl-1-adamantyl]butanamide |
|---|---|
| PubChem CID | 71514006 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 4-chloro-N-[(3R,5S)-3,5-dimethyl-1-adamantyl]butanamide |
| SMILES | C[C@]12CC3CC(NC(=O)CCCCl)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C16H26ClNO/c1-14-6-12-7-15(2,9-14)11-16(8-12,10-14)18-13(19)4-3-5-17/h12H,3-11H2,1-2H3,(H,18,19)/t12?,14-,15+,16? |
| InChIKey | IQJPQYNLEMJVKL-PYCGDYPRSA-N |
| XLogP | 3.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|