C16H28N2O — CID 79998241
3-amino-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide (PubChem CID 79998241) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-amino-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide.
| Compound Name | 3-amino-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 79998241 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-amino-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide |
| SMILES | CC(CN)C(=O)NC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C16H28N2O/c1-11(7-17)13(19)18-16-6-12-4-14(2,9-16)8-15(3,5-12)10-16/h11-12H,4-10,17H2,1-3H3,(H,18,19) |
| InChIKey | LDVQDIWPZVYTEJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |