About N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide
N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide (PubChem CID 98105097) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide |
| PubChem CID | 98105097 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide |
| SMILES | CC(=O)N[C@@]12CC3CC(C)(C1)C[C@@](NC(C)=O)(C3)C2 |
| InChI | InChI=1S/C15H24N2O2/c1-10(18)16-14-5-12-4-13(3,7-14)8-15(6-12,9-14)17-11(2)19/h12H,4-9H2,1-3H3,(H,16,18)(H,17,19)/t12?,13?,14-,15-/m0/s1 |
| InChIKey | ROJXOZJNYVQVOH-WUCCLRPBSA-N |
| XLogP | 1.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide?
The IUPAC name of N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide (CID 98105097) is N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide.
What is the SMILES notation for N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide?
The canonical SMILES for N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide is CC(=O)N[C@@]12CC3CC(C)(C1)C[C@@](NC(C)=O)(C3)C2.
What is the InChIKey of N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide?
The InChIKey is ROJXOZJNYVQVOH-WUCCLRPBSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-10(18)16-14-5-12-4-13(3,7-14)8-15(6-12,9-14)17-11(2)19/h12H,4-9H2,1-3H3,(H,16,18)(H,17,19)/t12?,13?,14-,15-/m0/s1.
What are the key properties of N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide?
N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide has a molecular weight of 264.37 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,3S)-3-acetamido-5-methyl-1-adamantyl]acetamide is sourced from PubChem (CID 98105097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).