About 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide
2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide (PubChem CID 79998257) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide |
| PubChem CID | 79998257 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)C(C)(C)C#N)(C3)C2 |
| InChI | InChI=1S/C17H26N2O/c1-14(2,11-18)13(20)19-17-7-12-5-15(3,9-17)8-16(4,6-12)10-17/h12H,5-10H2,1-4H3,(H,19,20) |
| InChIKey | UUQQBPSTTVHRES-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide?
The IUPAC name of 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide (CID 79998257) is 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide.
What is the SMILES notation for 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide?
The canonical SMILES for 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide is CC12CC3CC(C)(C1)CC(NC(=O)C(C)(C)C#N)(C3)C2.
What is the InChIKey of 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide?
The InChIKey is UUQQBPSTTVHRES-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c1-14(2,11-18)13(20)19-17-7-12-5-15(3,9-17)8-16(4,6-12)10-17/h12H,5-10H2,1-4H3,(H,19,20).
What are the key properties of 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide?
2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide has a molecular weight of 274.41 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-(3,5-dimethyl-1-adamantyl)-2-methylpropanamide is sourced from PubChem (CID 79998257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).