C19H32N2O — CID 27233877
1-cyclohexyl-3-[(3S,5R)-3,5-dimethyl-1-adamantyl]urea (PubChem CID 27233877) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(3S,5R)-3,5-dimethyl-1-adamantyl]urea.
| Compound Name | 1-cyclohexyl-3-[(3S,5R)-3,5-dimethyl-1-adamantyl]urea |
|---|---|
| PubChem CID | 27233877 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 1-cyclohexyl-3-[(3S,5R)-3,5-dimethyl-1-adamantyl]urea |
| SMILES | C[C@]12CC3CC(NC(=O)NC4CCCCC4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C19H32N2O/c1-17-8-14-9-18(2,11-17)13-19(10-14,12-17)21-16(22)20-15-6-4-3-5-7-15/h14-15H,3-13H2,1-2H3,(H2,20,21,22)/t14?,17-,18+,19? |
| InChIKey | LRFUYLAMPZGXQB-KOCGSPDRSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |