C19H25ClN2O — CID 98157418
1-(3-chlorophenyl)-3-[(3R,5R)-3,5-dimethyl-1-adamantyl]urea (PubChem CID 98157418) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(3R,5R)-3,5-dimethyl-1-adamantyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(3R,5R)-3,5-dimethyl-1-adamantyl]urea |
|---|---|
| PubChem CID | 98157418 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(3R,5R)-3,5-dimethyl-1-adamantyl]urea |
| SMILES | C[C@]12CC3CC(NC(=O)Nc4cccc(Cl)c4)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C19H25ClN2O/c1-17-7-13-8-18(2,10-17)12-19(9-13,11-17)22-16(23)21-15-5-3-4-14(20)6-15/h3-6,13H,7-12H2,1-2H3,(H2,21,22,23)/t13?,17-,18-,19?/m1/s1 |
| InChIKey | BUODOHUYRDRAHQ-HSOIFAIESA-N |
| XLogP | 5.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |