C25H36N4O2 — CID 175461156
1-[4-(4-aminopiperidine-1-carbonyl)phenyl]-3-[(3R,5S)-3,5-dimethyl-1-adamantyl]urea (PubChem CID 175461156) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[4-(4-aminopiperidine-1-carbonyl)phenyl]-3-[(3R,5S)-3,5-dimethyl-1-adamantyl]urea.
| Compound Name | 1-[4-(4-aminopiperidine-1-carbonyl)phenyl]-3-[(3R,5S)-3,5-dimethyl-1-adamantyl]urea |
|---|---|
| PubChem CID | 175461156 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 1-[4-(4-aminopiperidine-1-carbonyl)phenyl]-3-[(3R,5S)-3,5-dimethyl-1-adamantyl]urea |
| SMILES | C[C@]12CC3CC(NC(=O)Nc4ccc(C(=O)N5CCC(N)CC5)cc4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C25H36N4O2/c1-23-11-17-12-24(2,14-23)16-25(13-17,15-23)28-22(31)27-20-5-3-18(4-6-20)21(30)29-9-7-19(26)8-10-29/h3-6,17,19H,7-16,26H2,1-2H3,(H2,27,28,31)/t17?,23-,24+,25? |
| InChIKey | XZJATMHEMWEKGY-FXOOJFCESA-N |
| XLogP | 4.12 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |