C24H34N4O4 — CID 166062740
4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-[4-(hydroxyamino)-4-oxobutyl]benzamide (PubChem CID 166062740) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-[4-(hydroxyamino)-4-oxobutyl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-[4-(hydroxyamino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 166062740 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-N-[4-(hydroxyamino)-4-oxobutyl]benzamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)Nc1ccc(C(=O)NCCCC(=O)NO)cc1)(C3)C2 |
| InChI | InChI=1S/C24H34N4O4/c1-22-10-16-11-23(2,13-22)15-24(12-16,14-22)27-21(31)26-18-7-5-17(6-8-18)20(30)25-9-3-4-19(29)28-32/h5-8,16,32H,3-4,9-15H2,1-2H3,(H,25,30)(H,28,29)(H2,26,27,31) |
| InChIKey | NTEYMHMAHMRCDR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|