C29H44N4O4 — CID 175800776
4-[[(3S,5R)-3,5-dimethyl-1-adamantyl]carbamoylamino]-N-[9-(hydroxyamino)-9-oxononyl]benzamide (PubChem CID 175800776) has the molecular formula C29H44N4O4 and a molecular weight of 512.70 g/mol. Its IUPAC name is 4-[[(3S,5R)-3,5-dimethyl-1-adamantyl]carbamoylamino]-N-[9-(hydroxyamino)-9-oxononyl]benzamide.
| Compound Name | 4-[[(3S,5R)-3,5-dimethyl-1-adamantyl]carbamoylamino]-N-[9-(hydroxyamino)-9-oxononyl]benzamide |
|---|---|
| PubChem CID | 175800776 |
| Molecular Formula | C29H44N4O4 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | 4-[[(3S,5R)-3,5-dimethyl-1-adamantyl]carbamoylamino]-N-[9-(hydroxyamino)-9-oxononyl]benzamide |
| SMILES | C[C@]12CC3CC(NC(=O)Nc4ccc(C(=O)NCCCCCCCCC(=O)NO)cc4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C29H44N4O4/c1-27-15-21-16-28(2,18-27)20-29(17-21,19-27)32-26(36)31-23-12-10-22(11-13-23)25(35)30-14-8-6-4-3-5-7-9-24(34)33-37/h10-13,21,37H,3-9,14-20H2,1-2H3,(H,30,35)(H,33,34)(H2,31,32,36)/t21?,27-,28+,29? |
| InChIKey | WSRXXPSGTQLPAZ-NCMSXQFYSA-N |
| XLogP | 5.52 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|