C31H46FN5O4 — CID 175948810
(3S)-1-[[4-[[(3S,5R)-3,5-dimethyl-1-adamantyl]carbamoylamino]-3-fluorophenyl]methyl]-N-[5-(hydroxyamino)-5-oxopentyl]piperidine-3-carboxamide (PubChem CID 175948810) has the molecular formula C31H46FN5O4 and a molecular weight of 571.74 g/mol. Its IUPAC name is (3S)-1-[[4-[[(3S,5R)-3,5-dimethyl-1-adamantyl]carbamoylamino]-3-fluorophenyl]methyl]-N-[5-(hydroxyamino)-5-oxopentyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[[4-[[(3S,5R)-3,5-dimethyl-1-adamantyl]carbamoylamino]-3-fluorophenyl]methyl]-N-[5-(hydroxyamino)-5-oxopentyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 175948810 |
| Molecular Formula | C31H46FN5O4 |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | (3S)-1-[[4-[[(3S,5R)-3,5-dimethyl-1-adamantyl]carbamoylamino]-3-fluorophenyl]methyl]-N-[5-(hydroxyamino)-5-oxopentyl]piperidine-3-carboxamide |
| SMILES | C[C@]12CC3CC(NC(=O)Nc4ccc(CN5CCC[C@H](C(=O)NCCCCC(=O)NO)C5)cc4F)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C31H46FN5O4/c1-29-13-22-14-30(2,18-29)20-31(15-22,19-29)35-28(40)34-25-9-8-21(12-24(25)32)16-37-11-5-6-23(17-37)27(39)33-10-4-3-7-26(38)36-41/h8-9,12,22-23,41H,3-7,10-11,13-20H2,1-2H3,(H,33,39)(H,36,38)(H2,34,35,40)/t22?,23-,29-,30+,31?/m0/s1 |
| InChIKey | MTISPQGESHYBNU-ISBWYOCKSA-N |
| XLogP | 4.70 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|