C40H71BrN4O2 — CID 67872963
N-decyl-1-[[4-[[3-(decylcarbamoyl)piperidin-1-yl]methyl]phenyl]methyl]piperidine-3-carboxamide;hydrobromide (PubChem CID 67872963) has the molecular formula C40H71BrN4O2 and a molecular weight of 719.94 g/mol. Its IUPAC name is N-decyl-1-[[4-[[3-(decylcarbamoyl)piperidin-1-yl]methyl]phenyl]methyl]piperidine-3-carboxamide;hydrobromide.
| Compound Name | N-decyl-1-[[4-[[3-(decylcarbamoyl)piperidin-1-yl]methyl]phenyl]methyl]piperidine-3-carboxamide;hydrobromide |
|---|---|
| PubChem CID | 67872963 |
| Molecular Formula | C40H71BrN4O2 |
| Molecular Weight | 719.94 g/mol |
| Exact Mass | 718.48 |
| IUPAC Name | N-decyl-1-[[4-[[3-(decylcarbamoyl)piperidin-1-yl]methyl]phenyl]methyl]piperidine-3-carboxamide;hydrobromide |
| SMILES | Br.CCCCCCCCCCNC(=O)C1CCCN(Cc2ccc(CN3CCCC(C(=O)NCCCCCCCCCC)C3)cc2)C1 |
| InChI | InChI=1S/C40H70N4O2.BrH/c1-3-5-7-9-11-13-15-17-27-41-39(45)37-21-19-29-43(33-37)31-35-23-25-36(26-24-35)32-44-30-20-22-38(34-44)40(46)42-28-18-16-14-12-10-8-6-4-2;/h23-26,37-38H,3-22,27-34H2,1-2H3,(H,41,45)(H,42,46);1H |
| InChIKey | IYOYRKUTQVFGTA-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.94 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|