C25H37FN4O5S — CID 177382210
6-[[4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-3-fluorophenyl]sulfonylamino]-N-hydroxyhexanamide (PubChem CID 177382210) has the molecular formula C25H37FN4O5S and a molecular weight of 524.66 g/mol. Its IUPAC name is 6-[[4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-3-fluorophenyl]sulfonylamino]-N-hydroxyhexanamide.
| Compound Name | 6-[[4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-3-fluorophenyl]sulfonylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 177382210 |
| Molecular Formula | C25H37FN4O5S |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 6-[[4-[(3,5-dimethyl-1-adamantyl)carbamoylamino]-3-fluorophenyl]sulfonylamino]-N-hydroxyhexanamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)Nc1ccc(S(=O)(=O)NCCCCCC(=O)NO)cc1F)(C3)C2 |
| InChI | InChI=1S/C25H37FN4O5S/c1-23-11-17-12-24(2,14-23)16-25(13-17,15-23)29-22(32)28-20-8-7-18(10-19(20)26)36(34,35)27-9-5-3-4-6-21(31)30-33/h7-8,10,17,27,33H,3-6,9,11-16H2,1-2H3,(H,30,31)(H2,28,29,32) |
| InChIKey | REAFITKIRZLJDO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|