C27H40N4O3S — CID 166062812
4-[(3,5-dimethyl-1-adamantyl)carbamothioylamino]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (PubChem CID 166062812) has the molecular formula C27H40N4O3S and a molecular weight of 500.71 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1-adamantyl)carbamothioylamino]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-1-adamantyl)carbamothioylamino]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 166062812 |
| Molecular Formula | C27H40N4O3S |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 4-[(3,5-dimethyl-1-adamantyl)carbamothioylamino]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=S)Nc1ccc(C(=O)NCCCCCCC(=O)NO)cc1)(C3)C2 |
| InChI | InChI=1S/C27H40N4O3S/c1-25-13-19-14-26(2,16-25)18-27(15-19,17-25)30-24(35)29-21-10-8-20(9-11-21)23(33)28-12-6-4-3-5-7-22(32)31-34/h8-11,19,34H,3-7,12-18H2,1-2H3,(H,28,33)(H,31,32)(H2,29,30,35) |
| InChIKey | BOEXQYBFLUIJRB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|