C20H25N3S — CID 166594854
1-(4-cyanophenyl)-3-(3,5-dimethyl-1-adamantyl)thiourea (PubChem CID 166594854) has the molecular formula C20H25N3S and a molecular weight of 339.51 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(3,5-dimethyl-1-adamantyl)thiourea.
| Compound Name | 1-(4-cyanophenyl)-3-(3,5-dimethyl-1-adamantyl)thiourea |
|---|---|
| PubChem CID | 166594854 |
| Molecular Formula | C20H25N3S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(3,5-dimethyl-1-adamantyl)thiourea |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=S)Nc1ccc(C#N)cc1)(C3)C2 |
| InChI | InChI=1S/C20H25N3S/c1-18-7-15-8-19(2,11-18)13-20(9-15,12-18)23-17(24)22-16-5-3-14(10-21)4-6-16/h3-6,15H,7-9,11-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | RZSRHSBODJAADF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|