C18H24N2O — CID 71510461
N-[(3R,5S)-3,5-dimethyl-1-adamantyl]pyridine-3-carboxamide (PubChem CID 71510461) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[(3R,5S)-3,5-dimethyl-1-adamantyl]pyridine-3-carboxamide.
| Compound Name | N-[(3R,5S)-3,5-dimethyl-1-adamantyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71510461 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[(3R,5S)-3,5-dimethyl-1-adamantyl]pyridine-3-carboxamide |
| SMILES | C[C@]12CC3CC(NC(=O)c4cccnc4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C18H24N2O/c1-16-6-13-7-17(2,10-16)12-18(8-13,11-16)20-15(21)14-4-3-5-19-9-14/h3-5,9,13H,6-8,10-12H2,1-2H3,(H,20,21)/t13?,16-,17+,18? |
| InChIKey | RXERRVMMGQQHFI-DWLODGJJSA-N |
| XLogP | 3.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |