C19H25N3O2 — CID 3315534
N'-(3,5-dimethyladamantane-1-carbonyl)pyridine-3-carbohydrazide (PubChem CID 3315534) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N'-(3,5-dimethyladamantane-1-carbonyl)pyridine-3-carbohydrazide.
| Compound Name | N'-(3,5-dimethyladamantane-1-carbonyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 3315534 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N'-(3,5-dimethyladamantane-1-carbonyl)pyridine-3-carbohydrazide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)NNC(=O)c1cccnc1)(C3)C2 |
| InChI | InChI=1S/C19H25N3O2/c1-17-6-13-7-18(2,10-17)12-19(8-13,11-17)16(24)22-21-15(23)14-4-3-5-20-9-14/h3-5,9,13H,6-8,10-12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | ULXDPWZOQIWDNR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|