C19H23FO — CID 79995520
(3,5-dimethyl-1-adamantyl)-(3-fluorophenyl)methanone (PubChem CID 79995520) has the molecular formula C19H23FO and a molecular weight of 286.39 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)-(3-fluorophenyl)methanone.
| Compound Name | (3,5-dimethyl-1-adamantyl)-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 79995520 |
| Molecular Formula | C19H23FO |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)-(3-fluorophenyl)methanone |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)c1cccc(F)c1)(C3)C2 |
| InChI | InChI=1S/C19H23FO/c1-17-7-13-8-18(2,10-17)12-19(9-13,11-17)16(21)14-4-3-5-15(20)6-14/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | YVZXROATJLGJSZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |