C8H4Cl3FO — CID 21200944
2,2,2-trichloro-1-(3-fluorophenyl)ethanone (PubChem CID 21200944) has the molecular formula C8H4Cl3FO and a molecular weight of 241.48 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(3-fluorophenyl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 21200944 |
| Molecular Formula | C8H4Cl3FO |
| Molecular Weight | 241.48 g/mol |
| Exact Mass | 239.93 |
| IUPAC Name | 2,2,2-trichloro-1-(3-fluorophenyl)ethanone |
| SMILES | O=C(c1cccc(F)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H4Cl3FO/c9-8(10,11)7(13)5-2-1-3-6(12)4-5/h1-4H |
| InChIKey | IHYRGKYGTMBAAH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|