C11H4F10O — CID 146007001
2,2,3,3,4,4,5,5,5-nonafluoro-1-(3-fluorophenyl)pentan-1-one (PubChem CID 146007001) has the molecular formula C11H4F10O and a molecular weight of 342.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-1-(3-fluorophenyl)pentan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-(3-fluorophenyl)pentan-1-one |
|---|---|
| PubChem CID | 146007001 |
| Molecular Formula | C11H4F10O |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-(3-fluorophenyl)pentan-1-one |
| SMILES | O=C(c1cccc(F)c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H4F10O/c12-6-3-1-2-5(4-6)7(22)8(13,14)9(15,16)10(17,18)11(19,20)21/h1-4H |
| InChIKey | VHFIPHFHCVPECR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|