C12H9F7O — CID 146008234
1-(3-ethylphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 146008234) has the molecular formula C12H9F7O and a molecular weight of 302.19 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(3-ethylphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 146008234 |
| Molecular Formula | C12H9F7O |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(3-ethylphenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | CCc1cccc(C(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F7O/c1-2-7-4-3-5-8(6-7)9(20)10(13,14)11(15,16)12(17,18)19/h3-6H,2H2,1H3 |
| InChIKey | WSMJHHIQPBDRNM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|