C12H6ClF9O — CID 146005832
1-(3-chloro-4-methylphenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one (PubChem CID 146005832) has the molecular formula C12H6ClF9O and a molecular weight of 372.61 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one.
| Compound Name | 1-(3-chloro-4-methylphenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
|---|---|
| PubChem CID | 146005832 |
| Molecular Formula | C12H6ClF9O |
| Molecular Weight | 372.61 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
| SMILES | Cc1ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H6ClF9O/c1-5-2-3-6(4-7(5)13)8(23)9(14,15)10(16,17)11(18,19)12(20,21)22/h2-4H,1H3 |
| InChIKey | ZCDSLTJPCNZQPM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|