C13H9F9O2 — CID 146007229
2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-methoxy-2-methylphenyl)pentan-1-one (PubChem CID 146007229) has the molecular formula C13H9F9O2 and a molecular weight of 368.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-methoxy-2-methylphenyl)pentan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-methoxy-2-methylphenyl)pentan-1-one |
|---|---|
| PubChem CID | 146007229 |
| Molecular Formula | C13H9F9O2 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-(4-methoxy-2-methylphenyl)pentan-1-one |
| SMILES | COc1ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C13H9F9O2/c1-6-5-7(24-2)3-4-8(6)9(23)10(14,15)11(16,17)12(18,19)13(20,21)22/h3-5H,1-2H3 |
| InChIKey | RQIXJUSBWRDRKS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|