C17H7F17O4 — CID 139811436
2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-methoxybenzoic acid (PubChem CID 139811436) has the molecular formula C17H7F17O4 and a molecular weight of 598.21 g/mol. Its IUPAC name is 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-methoxybenzoic acid.
| Compound Name | 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 139811436 |
| Molecular Formula | C17H7F17O4 |
| Molecular Weight | 598.21 g/mol |
| Exact Mass | 598.01 |
| IUPAC Name | 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-methoxybenzoic acid |
| SMILES | COc1ccc(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H7F17O4/c1-37-5-2-3-7(6(4-5)10(35)36)38-9(19)8(18)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h2-4H,1H3,(H,35,36) |
| InChIKey | JVRBMHLWAXRZBY-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.21 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|