C26H25F17N2O6 — CID 139605545
tert-butyl N-[2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate (PubChem CID 139605545) has the molecular formula C26H25F17N2O6 and a molecular weight of 784.46 g/mol. Its IUPAC name is tert-butyl N-[2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 139605545 |
| Molecular Formula | C26H25F17N2O6 |
| Molecular Weight | 784.46 g/mol |
| Exact Mass | 784.14 |
| IUPAC Name | tert-butyl N-[2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-methoxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H25F17N2O6/c1-18(2,3)50-16(46)44-10-9-13(11(8-12(10)48-7)45-17(47)51-19(4,5)6)49-15(28)14(27)20(29,30)21(31,32)22(33,34)23(35,36)24(37,38)25(39,40)26(41,42)43/h8-9H,1-7H3,(H,44,46)(H,45,47) |
| InChIKey | SQISUTXGYJCXOR-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.46 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|