C25H22BrF17N2O5 — CID 139605571
tert-butyl N-[2-bromo-3-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate (PubChem CID 139605571) has the molecular formula C25H22BrF17N2O5 and a molecular weight of 833.33 g/mol. Its IUPAC name is tert-butyl N-[2-bromo-3-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-bromo-3-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 139605571 |
| Molecular Formula | C25H22BrF17N2O5 |
| Molecular Weight | 833.33 g/mol |
| Exact Mass | 832.04 |
| IUPAC Name | tert-butyl N-[2-bromo-3-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)OC(C)(C)C)c(Br)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22BrF17N2O5/c1-17(2,3)49-15(46)44-9-7-10(45-16(47)50-18(4,5)6)12(26)11(8-9)48-14(28)13(27)19(29,30)20(31,32)21(33,34)22(35,36)23(37,38)24(39,40)25(41,42)43/h7-8H,1-6H3,(H,44,46)(H,45,47) |
| InChIKey | KFWSTNWUXFLCEL-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.33 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|