C25H23F17N2O5 — CID 54526544
butyl N-[3-(butoxycarbonylamino)-5-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)phenyl]carbamate (PubChem CID 54526544) has the molecular formula C25H23F17N2O5 and a molecular weight of 754.43 g/mol. Its IUPAC name is butyl N-[3-(butoxycarbonylamino)-5-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)phenyl]carbamate.
| Compound Name | butyl N-[3-(butoxycarbonylamino)-5-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 54526544 |
| Molecular Formula | C25H23F17N2O5 |
| Molecular Weight | 754.43 g/mol |
| Exact Mass | 754.13 |
| IUPAC Name | butyl N-[3-(butoxycarbonylamino)-5-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1cc(NC(=O)OCCCC)cc(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C25H23F17N2O5/c1-3-5-7-47-17(45)43-12-9-13(44-18(46)48-8-6-4-2)11-14(10-12)49-16(27)15(26)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)24(38,39)25(40,41)42/h9-11H,3-8H2,1-2H3,(H,43,45)(H,44,46) |
| InChIKey | YTMQTAXLWAOXLB-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.43 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|