C12H13F11O — CID 175759743
1,2,3,3,4,4,5,5,6,6,6-undecafluoro-1-hexoxyhex-1-ene (PubChem CID 175759743) has the molecular formula C12H13F11O and a molecular weight of 382.21 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,5,6,6,6-undecafluoro-1-hexoxyhex-1-ene.
| Compound Name | 1,2,3,3,4,4,5,5,6,6,6-undecafluoro-1-hexoxyhex-1-ene |
|---|---|
| PubChem CID | 175759743 |
| Molecular Formula | C12H13F11O |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1,2,3,3,4,4,5,5,6,6,6-undecafluoro-1-hexoxyhex-1-ene |
| SMILES | CCCCCCOC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F11O/c1-2-3-4-5-6-24-8(14)7(13)9(15,16)10(17,18)11(19,20)12(21,22)23/h2-6H2,1H3 |
| InChIKey | YZMSXOFZGUSNBI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|