C7H5F9O — CID 172692823
1-ethoxy-1,2,3,3,4,4,5,5,5-nonafluoropent-1-ene (PubChem CID 172692823) has the molecular formula C7H5F9O and a molecular weight of 276.10 g/mol. Its IUPAC name is 1-ethoxy-1,2,3,3,4,4,5,5,5-nonafluoropent-1-ene.
| Compound Name | 1-ethoxy-1,2,3,3,4,4,5,5,5-nonafluoropent-1-ene |
|---|---|
| PubChem CID | 172692823 |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 1-ethoxy-1,2,3,3,4,4,5,5,5-nonafluoropent-1-ene |
| SMILES | CCOC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O/c1-2-17-4(9)3(8)5(10,11)6(12,13)7(14,15)16/h2H2,1H3 |
| InChIKey | BXJZEOYLNYDFII-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|