C8H6F7O3- — CID 4292676
1-ethoxy-4,4,5,5,6,6,6-heptafluoro-1-oxohex-2-en-3-olate (PubChem CID 4292676) has the molecular formula C8H6F7O3- and a molecular weight of 283.12 g/mol. Its IUPAC name is 1-ethoxy-4,4,5,5,6,6,6-heptafluoro-1-oxohex-2-en-3-olate.
| Compound Name | 1-ethoxy-4,4,5,5,6,6,6-heptafluoro-1-oxohex-2-en-3-olate |
|---|---|
| PubChem CID | 4292676 |
| Molecular Formula | C8H6F7O3- |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 1-ethoxy-4,4,5,5,6,6,6-heptafluoro-1-oxohex-2-en-3-olate |
| SMILES | CCOC(=O)C=C([O-])C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F7O3/c1-2-18-5(17)3-4(16)6(9,10)7(11,12)8(13,14)15/h3,16H,2H2,1H3/p-1 |
| InChIKey | MTHZMPNHGWYWJT-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|