C10H6ClF11O2 — CID 10916443
ethyl (E)-8-chloro-3,4,4,5,5,6,6,7,7,8,8-undecafluorooct-2-enoate (PubChem CID 10916443) has the molecular formula C10H6ClF11O2 and a molecular weight of 402.59 g/mol. Its IUPAC name is ethyl (E)-8-chloro-3,4,4,5,5,6,6,7,7,8,8-undecafluorooct-2-enoate.
| Compound Name | ethyl (E)-8-chloro-3,4,4,5,5,6,6,7,7,8,8-undecafluorooct-2-enoate |
|---|---|
| PubChem CID | 10916443 |
| Molecular Formula | C10H6ClF11O2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | ethyl (E)-8-chloro-3,4,4,5,5,6,6,7,7,8,8-undecafluorooct-2-enoate |
| SMILES | CCOC(=O)/C=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C10H6ClF11O2/c1-2-24-5(23)3-4(12)6(13,14)7(15,16)8(17,18)9(19,20)10(11,21)22/h3H,2H2,1H3/b4-3+ |
| InChIKey | YLPZUCKELAUBQC-ONEGZZNKSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|