C6H8Cl3NO2 — CID 73183108
ethyl 3-amino-4,4,4-trichlorobut-2-enoate (PubChem CID 73183108) has the molecular formula C6H8Cl3NO2 and a molecular weight of 232.49 g/mol. Its IUPAC name is ethyl 3-amino-4,4,4-trichlorobut-2-enoate.
| Compound Name | ethyl 3-amino-4,4,4-trichlorobut-2-enoate |
|---|---|
| PubChem CID | 73183108 |
| Molecular Formula | C6H8Cl3NO2 |
| Molecular Weight | 232.49 g/mol |
| Exact Mass | 230.96 |
| IUPAC Name | ethyl 3-amino-4,4,4-trichlorobut-2-enoate |
| SMILES | CCOC(=O)C=C(N)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl3NO2/c1-2-12-5(11)3-4(10)6(7,8)9/h3H,2,10H2,1H3 |
| InChIKey | JLMJKVDETFBFDI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|