C10H12Cl3F3O2 — CID 89438203
ethyl (Z)-5-chloro-4,4-bis(chloromethyl)-3-(trifluoromethyl)pent-2-enoate (PubChem CID 89438203) has the molecular formula C10H12Cl3F3O2 and a molecular weight of 327.56 g/mol. Its IUPAC name is ethyl (Z)-5-chloro-4,4-bis(chloromethyl)-3-(trifluoromethyl)pent-2-enoate.
| Compound Name | ethyl (Z)-5-chloro-4,4-bis(chloromethyl)-3-(trifluoromethyl)pent-2-enoate |
|---|---|
| PubChem CID | 89438203 |
| Molecular Formula | C10H12Cl3F3O2 |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | ethyl (Z)-5-chloro-4,4-bis(chloromethyl)-3-(trifluoromethyl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C(\C(F)(F)F)C(CCl)(CCl)CCl |
| InChI | InChI=1S/C10H12Cl3F3O2/c1-2-18-8(17)3-7(10(14,15)16)9(4-11,5-12)6-13/h3H,2,4-6H2,1H3/b7-3- |
| InChIKey | MVCFXGIUGYHWJT-CLTKARDFSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|