C14H21F3O4 — CID 11045107
ethyl (2E,4E)-7,7-diethoxy-3-(trifluoromethyl)hepta-2,4-dienoate (PubChem CID 11045107) has the molecular formula C14H21F3O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is ethyl (2E,4E)-7,7-diethoxy-3-(trifluoromethyl)hepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-7,7-diethoxy-3-(trifluoromethyl)hepta-2,4-dienoate |
|---|---|
| PubChem CID | 11045107 |
| Molecular Formula | C14H21F3O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl (2E,4E)-7,7-diethoxy-3-(trifluoromethyl)hepta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(\C=C\CC(OCC)OCC)C(F)(F)F |
| InChI | InChI=1S/C14H21F3O4/c1-4-19-12(18)10-11(14(15,16)17)8-7-9-13(20-5-2)21-6-3/h7-8,10,13H,4-6,9H2,1-3H3/b8-7+,11-10+ |
| InChIKey | LQJZZJAJGXQFMA-ZDVGBALWSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|