C11H13F3O3 — CID 11196021
ethyl (2E)-6-methyl-4-oxo-3-(trifluoromethyl)hepta-2,5-dienoate (PubChem CID 11196021) has the molecular formula C11H13F3O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is ethyl (2E)-6-methyl-4-oxo-3-(trifluoromethyl)hepta-2,5-dienoate.
| Compound Name | ethyl (2E)-6-methyl-4-oxo-3-(trifluoromethyl)hepta-2,5-dienoate |
|---|---|
| PubChem CID | 11196021 |
| Molecular Formula | C11H13F3O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | ethyl (2E)-6-methyl-4-oxo-3-(trifluoromethyl)hepta-2,5-dienoate |
| SMILES | CCOC(=O)/C=C(\C(=O)C=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H13F3O3/c1-4-17-10(16)6-8(11(12,13)14)9(15)5-7(2)3/h5-6H,4H2,1-3H3/b8-6+ |
| InChIKey | PZALGUZBGHJUEV-SOFGYWHQSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|