C16H23F3O2 — CID 135008239
ethyl (2E,5E)-6,10-dimethyl-3-(trifluoromethyl)undeca-2,5,9-trienoate (PubChem CID 135008239) has the molecular formula C16H23F3O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl (2E,5E)-6,10-dimethyl-3-(trifluoromethyl)undeca-2,5,9-trienoate.
| Compound Name | ethyl (2E,5E)-6,10-dimethyl-3-(trifluoromethyl)undeca-2,5,9-trienoate |
|---|---|
| PubChem CID | 135008239 |
| Molecular Formula | C16H23F3O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | ethyl (2E,5E)-6,10-dimethyl-3-(trifluoromethyl)undeca-2,5,9-trienoate |
| SMILES | CCOC(=O)/C=C(\C/C=C(\C)CCC=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H23F3O2/c1-5-21-15(20)11-14(16(17,18)19)10-9-13(4)8-6-7-12(2)3/h7,9,11H,5-6,8,10H2,1-4H3/b13-9+,14-11+ |
| InChIKey | YIQRHPWRDGGWDM-IJFRVEDASA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|