C22H33F3O5S — CID 101116690
ethyl (2Z,6Z,10E)-7,11,15-trimethyl-3-(trifluoromethylsulfonyloxy)hexadeca-2,6,10,14-tetraenoate (PubChem CID 101116690) has the molecular formula C22H33F3O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is ethyl (2Z,6Z,10E)-7,11,15-trimethyl-3-(trifluoromethylsulfonyloxy)hexadeca-2,6,10,14-tetraenoate.
| Compound Name | ethyl (2Z,6Z,10E)-7,11,15-trimethyl-3-(trifluoromethylsulfonyloxy)hexadeca-2,6,10,14-tetraenoate |
|---|---|
| PubChem CID | 101116690 |
| Molecular Formula | C22H33F3O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | ethyl (2Z,6Z,10E)-7,11,15-trimethyl-3-(trifluoromethylsulfonyloxy)hexadeca-2,6,10,14-tetraenoate |
| SMILES | CCOC(=O)/C=C(/CC/C=C(/C)CC/C=C(\C)CCC=C(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H33F3O5S/c1-6-29-21(26)16-20(30-31(27,28)22(23,24)25)15-9-14-19(5)13-8-12-18(4)11-7-10-17(2)3/h10,12,14,16H,6-9,11,13,15H2,1-5H3/b18-12+,19-14-,20-16- |
| InChIKey | QTXWWTGXELBACA-LTJJHALOSA-N |
| XLogP | 6.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|