C19H27F3O6S — CID 123852790
ethyl 9,13-dimethyl-3-oxo-5-(trifluoromethylsulfonyloxy)tetradeca-4,8,12-trienoate (PubChem CID 123852790) has the molecular formula C19H27F3O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is ethyl 9,13-dimethyl-3-oxo-5-(trifluoromethylsulfonyloxy)tetradeca-4,8,12-trienoate.
| Compound Name | ethyl 9,13-dimethyl-3-oxo-5-(trifluoromethylsulfonyloxy)tetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 123852790 |
| Molecular Formula | C19H27F3O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | ethyl 9,13-dimethyl-3-oxo-5-(trifluoromethylsulfonyloxy)tetradeca-4,8,12-trienoate |
| SMILES | CCOC(=O)CC(=O)C=C(CCC=C(C)CCC=C(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H27F3O6S/c1-5-27-18(24)13-16(23)12-17(28-29(25,26)19(20,21)22)11-7-10-15(4)9-6-8-14(2)3/h8,10,12H,5-7,9,11,13H2,1-4H3 |
| InChIKey | ZAGDEOVBUKVXAX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|