C13H19F3O — CID 72726260
1,1,1-trifluoro-6,10-dimethylundeca-5,9-dien-2-one (PubChem CID 72726260) has the molecular formula C13H19F3O and a molecular weight of 248.29 g/mol. Its IUPAC name is 1,1,1-trifluoro-6,10-dimethylundeca-5,9-dien-2-one.
| Compound Name | 1,1,1-trifluoro-6,10-dimethylundeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 72726260 |
| Molecular Formula | C13H19F3O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1,1,1-trifluoro-6,10-dimethylundeca-5,9-dien-2-one |
| SMILES | CC(C)=CCCC(C)=CCCC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H19F3O/c1-10(2)6-4-7-11(3)8-5-9-12(17)13(14,15)16/h6,8H,4-5,7,9H2,1-3H3 |
| InChIKey | VCHIQJZLMXWVDR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|