C28H43F3O — CID 10813531
(5E,9E,13E,17E)-1,1,1-trifluoro-5,9,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-2-one (PubChem CID 10813531) has the molecular formula C28H43F3O and a molecular weight of 452.65 g/mol. Its IUPAC name is (5E,9E,13E,17E)-1,1,1-trifluoro-5,9,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-2-one.
| Compound Name | (5E,9E,13E,17E)-1,1,1-trifluoro-5,9,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-2-one |
|---|---|
| PubChem CID | 10813531 |
| Molecular Formula | C28H43F3O |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (5E,9E,13E,17E)-1,1,1-trifluoro-5,9,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H43F3O/c1-22(2)12-9-15-25(5)18-10-16-23(3)13-7-8-14-24(4)17-11-19-26(6)20-21-27(32)28(29,30)31/h12-14,18-19H,7-11,15-17,20-21H2,1-6H3/b23-13+,24-14+,25-18+,26-19+ |
| InChIKey | YGTCJLYFHBJGDC-KDSGDVRDSA-N |
| XLogP | 9.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|