C29H44O — CID 14544618
(6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-6,10,14,18,22-pentaen-1-yn-3-one (PubChem CID 14544618) has the molecular formula C29H44O and a molecular weight of 408.67 g/mol. Its IUPAC name is (6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-6,10,14,18,22-pentaen-1-yn-3-one.
| Compound Name | (6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-6,10,14,18,22-pentaen-1-yn-3-one |
|---|---|
| PubChem CID | 14544618 |
| Molecular Formula | C29H44O |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | (6E,10E,14E,18E)-6,10,15,19,23-pentamethyltetracosa-6,10,14,18,22-pentaen-1-yn-3-one |
| SMILES | C#CC(=O)CC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C29H44O/c1-8-29(30)23-22-28(7)21-13-19-26(5)16-10-9-15-25(4)18-12-20-27(6)17-11-14-24(2)3/h1,14-16,20-21H,9-13,17-19,22-23H2,2-7H3/b25-15+,26-16+,27-20+,28-21+ |
| InChIKey | FWEQWEHMDNEBGX-BANQPHDMSA-N |
| XLogP | 8.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|