C8H9AlF3N3O2 — CID 152811733
ethyl (E)-3-[(E)-N-(alumanylamino)-C-cyanocarbonimidoyl]-4,4,4-trifluorobut-2-enoate (PubChem CID 152811733) has the molecular formula C8H9AlF3N3O2 and a molecular weight of 263.15 g/mol. Its IUPAC name is ethyl (E)-3-[(E)-N-(alumanylamino)-C-cyanocarbonimidoyl]-4,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (E)-3-[(E)-N-(alumanylamino)-C-cyanocarbonimidoyl]-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 152811733 |
| Molecular Formula | C8H9AlF3N3O2 |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | ethyl (E)-3-[(E)-N-(alumanylamino)-C-cyanocarbonimidoyl]-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(C(\C#N)=N/N[AlH2])/C(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O2.Al.2H/c1-2-16-7(15)3-5(8(9,10)11)6(4-12)14-13;;;/h3H,2H2,1H3,(H2,13,15);;;/q;+1;;/p-1 |
| InChIKey | SRHNBWHDEKKDDN-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|