C9H14AlF3N2O2 — CID 172923956
ethyl (E,4E)-4-(alumanylhydrazinylidene)-2-methyl-3-(trifluoromethyl)pent-2-enoate (PubChem CID 172923956) has the molecular formula C9H14AlF3N2O2 and a molecular weight of 266.20 g/mol. Its IUPAC name is ethyl (E,4E)-4-(alumanylhydrazinylidene)-2-methyl-3-(trifluoromethyl)pent-2-enoate.
| Compound Name | ethyl (E,4E)-4-(alumanylhydrazinylidene)-2-methyl-3-(trifluoromethyl)pent-2-enoate |
|---|---|
| PubChem CID | 172923956 |
| Molecular Formula | C9H14AlF3N2O2 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | ethyl (E,4E)-4-(alumanylhydrazinylidene)-2-methyl-3-(trifluoromethyl)pent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C(C(\C)=N\N[AlH2])/C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O2.Al.2H/c1-4-16-8(15)5(2)7(6(3)14-13)9(10,11)12;;;/h4H2,1-3H3,(H2,13,15);;;/q;+1;;/p-1 |
| InChIKey | TXCMSHRJIMDOJM-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|