C8H8Br3F3O2 — CID 89438283
ethyl (E)-4,4,4-trifluoro-2-methyl-3-(tribromomethyl)but-2-enoate (PubChem CID 89438283) has the molecular formula C8H8Br3F3O2 and a molecular weight of 432.86 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-2-methyl-3-(tribromomethyl)but-2-enoate.
| Compound Name | ethyl (E)-4,4,4-trifluoro-2-methyl-3-(tribromomethyl)but-2-enoate |
|---|---|
| PubChem CID | 89438283 |
| Molecular Formula | C8H8Br3F3O2 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 429.80 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-2-methyl-3-(tribromomethyl)but-2-enoate |
| SMILES | CCOC(=O)/C(C)=C(\C(F)(F)F)C(Br)(Br)Br |
| InChI | InChI=1S/C8H8Br3F3O2/c1-3-16-6(15)4(2)5(7(9,10)11)8(12,13)14/h3H2,1-2H3/b5-4- |
| InChIKey | WGBARWWYHVCBPW-PLNGDYQASA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|