About ethyl 2-hydroxyiminopropanoate
ethyl 2-hydroxyiminopropanoate (PubChem CID 6399798) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is ethyl 2-hydroxyiminopropanoate.
Molecular Properties
| Compound Name | ethyl 2-hydroxyiminopropanoate |
| PubChem CID | 6399798 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | ethyl 2-hydroxyiminopropanoate |
| SMILES | CCOC(=O)C(C)=NO |
| InChI | InChI=1S/C5H9NO3/c1-3-9-5(7)4(2)6-8/h8H,3H2,1-2H3 |
| InChIKey | BJBDPHKMAMMTFW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydroxyiminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxyiminopropanoate?
The IUPAC name of ethyl 2-hydroxyiminopropanoate (CID 6399798) is ethyl 2-hydroxyiminopropanoate.
What is the SMILES notation for ethyl 2-hydroxyiminopropanoate?
The canonical SMILES for ethyl 2-hydroxyiminopropanoate is CCOC(=O)C(C)=NO.
What is the InChIKey of ethyl 2-hydroxyiminopropanoate?
The InChIKey is BJBDPHKMAMMTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-3-9-5(7)4(2)6-8/h8H,3H2,1-2H3.
What are the key properties of ethyl 2-hydroxyiminopropanoate?
ethyl 2-hydroxyiminopropanoate has a molecular weight of 131.13 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxyiminopropanoate is sourced from PubChem (CID 6399798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).