About ethyl 2-oxopropanoate;nitrous acid
ethyl 2-oxopropanoate;nitrous acid (PubChem CID 174912891) has the molecular formula C5H9NO5
and a molecular weight of 163.13 g/mol. Its IUPAC name is ethyl 2-oxopropanoate;nitrous acid.
Molecular Properties
| Compound Name | ethyl 2-oxopropanoate;nitrous acid |
| PubChem CID | 174912891 |
| Molecular Formula | C5H9NO5 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | ethyl 2-oxopropanoate;nitrous acid |
| SMILES | CCOC(=O)C(C)=O.O=NO |
| InChI | InChI=1S/C5H8O3.HNO2/c1-3-8-5(7)4(2)6;2-1-3/h3H2,1-2H3;(H,2,3) |
| InChIKey | WSEMDXYZXHPNHH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-oxopropanoate;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxopropanoate;nitrous acid?
The IUPAC name of ethyl 2-oxopropanoate;nitrous acid (CID 174912891) is ethyl 2-oxopropanoate;nitrous acid.
What is the SMILES notation for ethyl 2-oxopropanoate;nitrous acid?
The canonical SMILES for ethyl 2-oxopropanoate;nitrous acid is CCOC(=O)C(C)=O.O=NO.
What is the InChIKey of ethyl 2-oxopropanoate;nitrous acid?
The InChIKey is WSEMDXYZXHPNHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.HNO2/c1-3-8-5(7)4(2)6;2-1-3/h3H2,1-2H3;(H,2,3).
What are the key properties of ethyl 2-oxopropanoate;nitrous acid?
ethyl 2-oxopropanoate;nitrous acid has a molecular weight of 163.13 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxopropanoate;nitrous acid is sourced from PubChem (CID 174912891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).