C11H22O6 — CID 157409750
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;ethyl 2-oxopropanoate (PubChem CID 157409750) has the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;ethyl 2-oxopropanoate.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;ethyl 2-oxopropanoate |
|---|---|
| PubChem CID | 157409750 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;ethyl 2-oxopropanoate |
| SMILES | CCC(CO)(CO)CO.CCOC(=O)C(C)=O |
| InChI | InChI=1S/C6H14O3.C5H8O3/c1-2-6(3-7,4-8)5-9;1-3-8-5(7)4(2)6/h7-9H,2-5H2,1H3;3H2,1-2H3 |
| InChIKey | BODDXEUDZLDASH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|