C18H26O12 — CID 131717147
diethyl 3-(2-ethoxy-2-oxoacetyl)-3-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]-2,4-dioxopentanedioate (PubChem CID 131717147) has the molecular formula C18H26O12 and a molecular weight of 434.39 g/mol. Its IUPAC name is diethyl 3-(2-ethoxy-2-oxoacetyl)-3-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]-2,4-dioxopentanedioate.
| Compound Name | diethyl 3-(2-ethoxy-2-oxoacetyl)-3-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]-2,4-dioxopentanedioate |
|---|---|
| PubChem CID | 131717147 |
| Molecular Formula | C18H26O12 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | diethyl 3-(2-ethoxy-2-oxoacetyl)-3-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]-2,4-dioxopentanedioate |
| SMILES | CCOC(=O)C(=O)C(CC(CO)(CO)CO)(C(=O)C(=O)OCC)C(=O)C(=O)OCC |
| InChI | InChI=1S/C18H26O12/c1-4-28-14(25)11(22)18(12(23)15(26)29-5-2,13(24)16(27)30-6-3)7-17(8-19,9-20)10-21/h19-21H,4-10H2,1-3H3 |
| InChIKey | VCOACCLRIBMQGB-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|