C7H9F3O2S — CID 88999258
ethyl (2Z)-4,4,4-trifluoro-2-(sulfanylmethylidene)butanoate (PubChem CID 88999258) has the molecular formula C7H9F3O2S and a molecular weight of 214.21 g/mol. Its IUPAC name is ethyl (2Z)-4,4,4-trifluoro-2-(sulfanylmethylidene)butanoate.
| Compound Name | ethyl (2Z)-4,4,4-trifluoro-2-(sulfanylmethylidene)butanoate |
|---|---|
| PubChem CID | 88999258 |
| Molecular Formula | C7H9F3O2S |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | ethyl (2Z)-4,4,4-trifluoro-2-(sulfanylmethylidene)butanoate |
| SMILES | CCOC(=O)/C(=C\S)CC(F)(F)F |
| InChI | InChI=1S/C7H9F3O2S/c1-2-12-6(11)5(4-13)3-7(8,9)10/h4,13H,2-3H2,1H3/b5-4- |
| InChIKey | SAJWQVDJENNZIF-PLNGDYQASA-N |
| XLogP | 2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|