C9H14F3NO2 — CID 150951259
ethyl 2-(dimethylaminomethylidene)-4,4,4-trifluorobutanoate (PubChem CID 150951259) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is ethyl 2-(dimethylaminomethylidene)-4,4,4-trifluorobutanoate.
| Compound Name | ethyl 2-(dimethylaminomethylidene)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 150951259 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | ethyl 2-(dimethylaminomethylidene)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C(=CN(C)C)CC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2/c1-4-15-8(14)7(6-13(2)3)5-9(10,11)12/h6H,4-5H2,1-3H3 |
| InChIKey | LKDLOUOGUWABOC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|