C11H19NO2 — CID 58644957
ethyl (2Z,4E)-5-(dimethylamino)-2-ethylpenta-2,4-dienoate (PubChem CID 58644957) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-(dimethylamino)-2-ethylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-(dimethylamino)-2-ethylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 58644957 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | ethyl (2Z,4E)-5-(dimethylamino)-2-ethylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C\C=C\N(C)C)CC |
| InChI | InChI=1S/C11H19NO2/c1-5-10(11(13)14-6-2)8-7-9-12(3)4/h7-9H,5-6H2,1-4H3/b9-7+,10-8- |
| InChIKey | TZPGCCGHOQPSBE-ZWOQCJTASA-N |
| XLogP | 1.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|